C29H37ClFNO2 — CID 22406761
[1-[1-(2-chlorophenyl)cyclopropyl]-6-fluoro-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl] decanoate (PubChem CID 22406761) has the molecular formula C29H37ClFNO2 and a molecular weight of 486.07 g/mol. Its IUPAC name is [1-[1-(2-chlorophenyl)cyclopropyl]-6-fluoro-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl] decanoate.
| Compound Name | [1-[1-(2-chlorophenyl)cyclopropyl]-6-fluoro-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl] decanoate |
|---|---|
| PubChem CID | 22406761 |
| Molecular Formula | C29H37ClFNO2 |
| Molecular Weight | 486.07 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | [1-[1-(2-chlorophenyl)cyclopropyl]-6-fluoro-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)Oc1cc2c(cc1F)CCN(C)C2C1(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C29H37ClFNO2/c1-3-4-5-6-7-8-9-14-27(33)34-26-20-22-21(19-25(26)31)15-18-32(2)28(22)29(16-17-29)23-12-10-11-13-24(23)30/h10-13,19-20,28H,3-9,14-18H2,1-2H3 |
| InChIKey | HBVDEXCJALUQMJ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.07 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|