C22H29BrN2O — CID 10740666
8-bromo-3-[4-(dimethylamino)butyl]-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol (PubChem CID 10740666) has the molecular formula C22H29BrN2O and a molecular weight of 417.39 g/mol. Its IUPAC name is 8-bromo-3-[4-(dimethylamino)butyl]-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol.
| Compound Name | 8-bromo-3-[4-(dimethylamino)butyl]-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
|---|---|
| PubChem CID | 10740666 |
| Molecular Formula | C22H29BrN2O |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 8-bromo-3-[4-(dimethylamino)butyl]-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
| SMILES | CN(C)CCCCN1CCc2cc(Br)c(O)cc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C22H29BrN2O/c1-24(2)11-6-7-12-25-13-10-18-14-21(23)22(26)15-19(18)20(16-25)17-8-4-3-5-9-17/h3-5,8-9,14-15,20,26H,6-7,10-13,16H2,1-2H3 |
| InChIKey | AEFMBWDXTMRYHD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|