C17H19NO2 — CID 102328393
(5S)-8-methoxy-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol (PubChem CID 102328393) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is (5S)-8-methoxy-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol.
| Compound Name | (5S)-8-methoxy-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol |
|---|---|
| PubChem CID | 102328393 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (5S)-8-methoxy-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol |
| SMILES | COc1cc2c(cc1O)[C@H](c1ccccc1)CNCC2 |
| InChI | InChI=1S/C17H19NO2/c1-20-17-9-13-7-8-18-11-15(14(13)10-16(17)19)12-5-3-2-4-6-12/h2-6,9-10,15,18-19H,7-8,11H2,1H3/t15-/m0/s1 |
| InChIKey | KJTCMLYTSGLTBF-HNNXBMFYSA-N |
| XLogP | 2.68 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |