C22H26ClNO4 — CID 161238561
(5-phenyl-7-propanoyloxy-2,3,4,5-tetrahydro-1H-3-benzazepin-8-yl) propanoate;hydrochloride (PubChem CID 161238561) has the molecular formula C22H26ClNO4 and a molecular weight of 403.91 g/mol. Its IUPAC name is (5-phenyl-7-propanoyloxy-2,3,4,5-tetrahydro-1H-3-benzazepin-8-yl) propanoate;hydrochloride.
| Compound Name | (5-phenyl-7-propanoyloxy-2,3,4,5-tetrahydro-1H-3-benzazepin-8-yl) propanoate;hydrochloride |
|---|---|
| PubChem CID | 161238561 |
| Molecular Formula | C22H26ClNO4 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (5-phenyl-7-propanoyloxy-2,3,4,5-tetrahydro-1H-3-benzazepin-8-yl) propanoate;hydrochloride |
| SMILES | CCC(=O)Oc1cc2c(cc1OC(=O)CC)C(c1ccccc1)CNCC2.Cl |
| InChI | InChI=1S/C22H25NO4.ClH/c1-3-21(24)26-19-12-16-10-11-23-14-18(15-8-6-5-7-9-15)17(16)13-20(19)27-22(25)4-2;/h5-9,12-13,18,23H,3-4,10-11,14H2,1-2H3;1H |
| InChIKey | UZRSCXSKSATNCO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|