C16H17NO — CID 10037257
(5R)-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol (PubChem CID 10037257) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is (5R)-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol.
| Compound Name | (5R)-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol |
|---|---|
| PubChem CID | 10037257 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (5R)-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol |
| SMILES | Oc1ccc2c(c1)[C@@H](c1ccccc1)CNCC2 |
| InChI | InChI=1S/C16H17NO/c18-14-7-6-13-8-9-17-11-16(15(13)10-14)12-4-2-1-3-5-12/h1-7,10,16-18H,8-9,11H2/t16-/m1/s1 |
| InChIKey | SNXWZKKKYZCZRK-MRXNPFEDSA-N |
| XLogP | 2.67 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |