C15H21NO3 — CID 122234873
[(1R,3S)-3-ethyl-6-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-7-yl] acetate (PubChem CID 122234873) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is [(1R,3S)-3-ethyl-6-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-7-yl] acetate.
| Compound Name | [(1R,3S)-3-ethyl-6-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-7-yl] acetate |
|---|---|
| PubChem CID | 122234873 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | [(1R,3S)-3-ethyl-6-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-7-yl] acetate |
| SMILES | CC[C@H]1Cc2cc(OC)c(OC(C)=O)cc2[C@@H](C)N1 |
| InChI | InChI=1S/C15H21NO3/c1-5-12-6-11-7-14(18-4)15(19-10(3)17)8-13(11)9(2)16-12/h7-9,12,16H,5-6H2,1-4H3/t9-,12+/m1/s1 |
| InChIKey | PIKWEBDPDJVYRE-SKDRFNHKSA-N |
| XLogP | 2.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|