C26H24N2O2S — CID 57498442
2-[(1R,3S)-6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinolin-3-yl]-4-phenyl-1,3-thiazole (PubChem CID 57498442) has the molecular formula C26H24N2O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is 2-[(1R,3S)-6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinolin-3-yl]-4-phenyl-1,3-thiazole.
| Compound Name | 2-[(1R,3S)-6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinolin-3-yl]-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 57498442 |
| Molecular Formula | C26H24N2O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-[(1R,3S)-6,7-dimethoxy-1-phenyl-1,2,3,4-tetrahydroisoquinolin-3-yl]-4-phenyl-1,3-thiazole |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1ccccc1)N[C@H](c1nc(-c3ccccc3)cs1)C2 |
| InChI | InChI=1S/C26H24N2O2S/c1-29-23-14-19-13-21(26-28-22(16-31-26)17-9-5-3-6-10-17)27-25(18-11-7-4-8-12-18)20(19)15-24(23)30-2/h3-12,14-16,21,25,27H,13H2,1-2H3/t21-,25+/m0/s1 |
| InChIKey | SMFVMEKHCPSMIE-SQJMNOBHSA-N |
| XLogP | 5.80 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |