C25H28N2O3 — CID 46956298
4-[(1R,3R)-6,7-dimethoxy-3-(5-methyl-2-pyridinyl)-1,2,3,4-tetrahydroisoquinolin-1-yl]-2,6-dimethylphenol (PubChem CID 46956298) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 4-[(1R,3R)-6,7-dimethoxy-3-(5-methyl-2-pyridinyl)-1,2,3,4-tetrahydroisoquinolin-1-yl]-2,6-dimethylphenol.
| Compound Name | 4-[(1R,3R)-6,7-dimethoxy-3-(5-methyl-2-pyridinyl)-1,2,3,4-tetrahydroisoquinolin-1-yl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 46956298 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 4-[(1R,3R)-6,7-dimethoxy-3-(5-methyl-2-pyridinyl)-1,2,3,4-tetrahydroisoquinolin-1-yl]-2,6-dimethylphenol |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1cc(C)c(O)c(C)c1)N[C@@H](c1ccc(C)cn1)C2 |
| InChI | InChI=1S/C25H28N2O3/c1-14-6-7-20(26-13-14)21-10-17-11-22(29-4)23(30-5)12-19(17)24(27-21)18-8-15(2)25(28)16(3)9-18/h6-9,11-13,21,24,27-28H,10H2,1-5H3/t21-,24-/m1/s1 |
| InChIKey | GBYQSECXFBLHBA-ZJSXRUAMSA-N |
| XLogP | 4.71 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |