C20H20N2O3 — CID 27879417
(9R)-6,7-dimethoxy-9-pyridin-3-yl-3,4,9,10-tetrahydro-2H-acridin-1-one (PubChem CID 27879417) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (9R)-6,7-dimethoxy-9-pyridin-3-yl-3,4,9,10-tetrahydro-2H-acridin-1-one.
| Compound Name | (9R)-6,7-dimethoxy-9-pyridin-3-yl-3,4,9,10-tetrahydro-2H-acridin-1-one |
|---|---|
| PubChem CID | 27879417 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (9R)-6,7-dimethoxy-9-pyridin-3-yl-3,4,9,10-tetrahydro-2H-acridin-1-one |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1cccnc1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C20H20N2O3/c1-24-17-9-13-15(10-18(17)25-2)22-14-6-3-7-16(23)20(14)19(13)12-5-4-8-21-11-12/h4-5,8-11,19,22H,3,6-7H2,1-2H3/t19-/m1/s1 |
| InChIKey | QZZBXQXIAFGNRT-LJQANCHMSA-N |
| XLogP | 3.66 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |