C23H23NO6 — CID 27879512
(10R)-10-(2,4,5-trimethoxyphenyl)-6,7,8,10-tetrahydro-5H-[1,3]benzodioxolo[5,6-b]quinolin-9-one (PubChem CID 27879512) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is (10R)-10-(2,4,5-trimethoxyphenyl)-6,7,8,10-tetrahydro-5H-[1,3]benzodioxolo[5,6-b]quinolin-9-one.
| Compound Name | (10R)-10-(2,4,5-trimethoxyphenyl)-6,7,8,10-tetrahydro-5H-[1,3]benzodioxolo[5,6-b]quinolin-9-one |
|---|---|
| PubChem CID | 27879512 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (10R)-10-(2,4,5-trimethoxyphenyl)-6,7,8,10-tetrahydro-5H-[1,3]benzodioxolo[5,6-b]quinolin-9-one |
| SMILES | COc1cc(OC)c([C@@H]2C3=C(CCCC3=O)Nc3cc4c(cc32)OCO4)cc1OC |
| InChI | InChI=1S/C23H23NO6/c1-26-17-10-19(28-3)18(27-2)8-13(17)22-12-7-20-21(30-11-29-20)9-15(12)24-14-5-4-6-16(25)23(14)22/h7-10,22,24H,4-6,11H2,1-3H3/t22-/m1/s1 |
| InChIKey | ROVMGTZINLJFBA-JOCHJYFZSA-N |
| XLogP | 4.01 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |