C21H17NO8 — CID 51138441
8-(6,7-dimethoxy-1,3-benzodioxol-4-yl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one (PubChem CID 51138441) has the molecular formula C21H17NO8 and a molecular weight of 411.37 g/mol. Its IUPAC name is 8-(6,7-dimethoxy-1,3-benzodioxol-4-yl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one.
| Compound Name | 8-(6,7-dimethoxy-1,3-benzodioxol-4-yl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one |
|---|---|
| PubChem CID | 51138441 |
| Molecular Formula | C21H17NO8 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 8-(6,7-dimethoxy-1,3-benzodioxol-4-yl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one |
| SMILES | COc1cc(C2C3=C(COC3=O)Nc3cc4c(cc32)OCO4)c2c(c1OC)OCO2 |
| InChI | InChI=1S/C21H17NO8/c1-24-15-4-10(18-20(19(15)25-2)30-8-29-18)16-9-3-13-14(28-7-27-13)5-11(9)22-12-6-26-21(23)17(12)16/h3-5,16,22H,6-8H2,1-2H3 |
| InChIKey | PISIDXWFTUBCKD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |