C19H17NO4 — CID 102133784
(9R)-6,7-dimethoxy-9-phenyl-4,9-dihydro-3H-furo[3,4-b]quinolin-1-one (PubChem CID 102133784) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is (9R)-6,7-dimethoxy-9-phenyl-4,9-dihydro-3H-furo[3,4-b]quinolin-1-one.
| Compound Name | (9R)-6,7-dimethoxy-9-phenyl-4,9-dihydro-3H-furo[3,4-b]quinolin-1-one |
|---|---|
| PubChem CID | 102133784 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (9R)-6,7-dimethoxy-9-phenyl-4,9-dihydro-3H-furo[3,4-b]quinolin-1-one |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1ccccc1)C1=C(COC1=O)N2 |
| InChI | InChI=1S/C19H17NO4/c1-22-15-8-12-13(9-16(15)23-2)20-14-10-24-19(21)18(14)17(12)11-6-4-3-5-7-11/h3-9,17,20H,10H2,1-2H3/t17-/m1/s1 |
| InChIKey | SNHZLYXHAFUGDT-QGZVFWFLSA-N |
| XLogP | 3.07 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |