C19H13NO6 — CID 92846250
(8S)-8-(1,3-benzodioxol-5-yl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one (PubChem CID 92846250) has the molecular formula C19H13NO6 and a molecular weight of 351.31 g/mol. Its IUPAC name is (8S)-8-(1,3-benzodioxol-5-yl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one.
| Compound Name | (8S)-8-(1,3-benzodioxol-5-yl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one |
|---|---|
| PubChem CID | 92846250 |
| Molecular Formula | C19H13NO6 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (8S)-8-(1,3-benzodioxol-5-yl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraen-6-one |
| SMILES | O=C1OCC2=C1[C@@H](c1ccc3c(c1)OCO3)c1cc3c(cc1N2)OCO3 |
| InChI | InChI=1S/C19H13NO6/c21-19-18-12(6-22-19)20-11-5-16-15(25-8-26-16)4-10(11)17(18)9-1-2-13-14(3-9)24-7-23-13/h1-5,17,20H,6-8H2/t17-/m0/s1 |
| InChIKey | FSXMKAZBIRAPIE-KRWDZBQOSA-N |
| XLogP | 2.51 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |