C22H15NO4 — CID 7419102
(17R)-17-(1,3-benzodioxol-5-yl)-14-oxa-11-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaen-15-one (PubChem CID 7419102) has the molecular formula C22H15NO4 and a molecular weight of 357.37 g/mol. Its IUPAC name is (17R)-17-(1,3-benzodioxol-5-yl)-14-oxa-11-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaen-15-one.
| Compound Name | (17R)-17-(1,3-benzodioxol-5-yl)-14-oxa-11-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaen-15-one |
|---|---|
| PubChem CID | 7419102 |
| Molecular Formula | C22H15NO4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (17R)-17-(1,3-benzodioxol-5-yl)-14-oxa-11-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaen-15-one |
| SMILES | O=C1OCC2=C1[C@H](c1ccc3c(c1)OCO3)c1c(ccc3ccccc13)N2 |
| InChI | InChI=1S/C22H15NO4/c24-22-21-16(10-25-22)23-15-7-5-12-3-1-2-4-14(12)20(15)19(21)13-6-8-17-18(9-13)27-11-26-17/h1-9,19,23H,10-11H2/t19-/m1/s1 |
| InChIKey | BUNXWJURMDKAJL-LJQANCHMSA-N |
| XLogP | 3.94 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |