C20H16ClNO4 — CID 44593033
9-(3-chlorophenyl)-5-methyl-6,13,15-trioxa-2-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3(8),10,12(16)-tetraen-7-one (PubChem CID 44593033) has the molecular formula C20H16ClNO4 and a molecular weight of 369.80 g/mol. Its IUPAC name is 9-(3-chlorophenyl)-5-methyl-6,13,15-trioxa-2-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3(8),10,12(16)-tetraen-7-one.
| Compound Name | 9-(3-chlorophenyl)-5-methyl-6,13,15-trioxa-2-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3(8),10,12(16)-tetraen-7-one |
|---|---|
| PubChem CID | 44593033 |
| Molecular Formula | C20H16ClNO4 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 9-(3-chlorophenyl)-5-methyl-6,13,15-trioxa-2-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3(8),10,12(16)-tetraen-7-one |
| SMILES | CC1CC2=C(C(=O)O1)C(c1cccc(Cl)c1)c1cc3c(cc1N2)OCO3 |
| InChI | InChI=1S/C20H16ClNO4/c1-10-5-15-19(20(23)26-10)18(11-3-2-4-12(21)6-11)13-7-16-17(25-9-24-16)8-14(13)22-15/h2-4,6-8,10,18,22H,5,9H2,1H3 |
| InChIKey | XLYBTASYNKDQQN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |