C19H16ClNO2 — CID 44593017
8-(3-chlorophenyl)-12,14-dioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraene (PubChem CID 44593017) has the molecular formula C19H16ClNO2 and a molecular weight of 325.80 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-12,14-dioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraene.
| Compound Name | 8-(3-chlorophenyl)-12,14-dioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraene |
|---|---|
| PubChem CID | 44593017 |
| Molecular Formula | C19H16ClNO2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 8-(3-chlorophenyl)-12,14-dioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),3(7),9,11(15)-tetraene |
| SMILES | Clc1cccc(C2C3=C(CCC3)Nc3cc4c(cc32)OCO4)c1 |
| InChI | InChI=1S/C19H16ClNO2/c20-12-4-1-3-11(7-12)19-13-5-2-6-15(13)21-16-9-18-17(8-14(16)19)22-10-23-18/h1,3-4,7-9,19,21H,2,5-6,10H2 |
| InChIKey | GWBPIVXNDUUQGD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |