C20H18ClNO5S — CID 44593035
9-(3-chlorophenyl)-4,4-dimethyl-6,13,15-trioxa-7λ6-thia-2-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3(8),10,12(16)-tetraene 7,7-dioxide (PubChem CID 44593035) has the molecular formula C20H18ClNO5S and a molecular weight of 419.89 g/mol. Its IUPAC name is 9-(3-chlorophenyl)-4,4-dimethyl-6,13,15-trioxa-7λ6-thia-2-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3(8),10,12(16)-tetraene 7,7-dioxide.
| Compound Name | 9-(3-chlorophenyl)-4,4-dimethyl-6,13,15-trioxa-7λ6-thia-2-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3(8),10,12(16)-tetraene 7,7-dioxide |
|---|---|
| PubChem CID | 44593035 |
| Molecular Formula | C20H18ClNO5S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 9-(3-chlorophenyl)-4,4-dimethyl-6,13,15-trioxa-7λ6-thia-2-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3(8),10,12(16)-tetraene 7,7-dioxide |
| SMILES | CC1(C)COS(=O)(=O)C2=C1Nc1cc3c(cc1C2c1cccc(Cl)c1)OCO3 |
| InChI | InChI=1S/C20H18ClNO5S/c1-20(2)9-27-28(23,24)18-17(11-4-3-5-12(21)6-11)13-7-15-16(26-10-25-15)8-14(13)22-19(18)20/h3-8,17,22H,9-10H2,1-2H3 |
| InChIKey | BSLNQKRENRBHNL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|