C21H25NO7 — CID 44568039
(NE)-N-[4,5,6-trimethoxy-3-(3,4,5-trimethoxyphenyl)-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 44568039) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is (NE)-N-[4,5,6-trimethoxy-3-(3,4,5-trimethoxyphenyl)-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[4,5,6-trimethoxy-3-(3,4,5-trimethoxyphenyl)-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 44568039 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (NE)-N-[4,5,6-trimethoxy-3-(3,4,5-trimethoxyphenyl)-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | COc1cc(C2C/C(=N\O)c3cc(OC)c(OC)c(OC)c32)cc(OC)c1OC |
| InChI | InChI=1S/C21H25NO7/c1-24-15-7-11(8-16(25-2)19(15)27-4)12-9-14(22-23)13-10-17(26-3)20(28-5)21(29-6)18(12)13/h7-8,10,12,23H,9H2,1-6H3/b22-14+ |
| InChIKey | PGZDKIOMFRFTMR-HYARGMPZSA-N |
| XLogP | 3.45 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|