C24H32O8 — CID 72773069
[3-(hydroxymethyl)-5,6,7-trimethoxy-4-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methanol (PubChem CID 72773069) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is [3-(hydroxymethyl)-5,6,7-trimethoxy-4-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methanol.
| Compound Name | [3-(hydroxymethyl)-5,6,7-trimethoxy-4-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 72773069 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [3-(hydroxymethyl)-5,6,7-trimethoxy-4-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methanol |
| SMILES | COc1cc(C2c3c(cc(OC)c(OC)c3OC)CC(CO)C2CO)cc(OC)c1OC |
| InChI | InChI=1S/C24H32O8/c1-27-17-9-14(10-18(28-2)22(17)30-4)20-16(12-26)15(11-25)7-13-8-19(29-3)23(31-5)24(32-6)21(13)20/h8-10,15-16,20,25-26H,7,11-12H2,1-6H3 |
| InChIKey | GZDNLIQJLPCMPD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |