C21H26O8 — CID 162979657
1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6,8-dimethoxy-1,2,3,4-tetrahydronaphthalene-2,7-diol (PubChem CID 162979657) has the molecular formula C21H26O8 and a molecular weight of 406.43 g/mol. Its IUPAC name is 1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6,8-dimethoxy-1,2,3,4-tetrahydronaphthalene-2,7-diol.
| Compound Name | 1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6,8-dimethoxy-1,2,3,4-tetrahydronaphthalene-2,7-diol |
|---|---|
| PubChem CID | 162979657 |
| Molecular Formula | C21H26O8 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6,8-dimethoxy-1,2,3,4-tetrahydronaphthalene-2,7-diol |
| SMILES | COc1cc(C2c3c(cc(OC)c(O)c3OC)CC(CO)C2O)cc(OC)c1O |
| InChI | InChI=1S/C21H26O8/c1-26-13-7-11(8-14(27-2)19(13)24)16-17-10(5-12(9-22)18(16)23)6-15(28-3)20(25)21(17)29-4/h6-8,12,16,18,22-25H,5,9H2,1-4H3 |
| InChIKey | GDBBKCKALIZFBE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |