C17H17N5O5 — CID 135413840
10-(3,4,5-trimethoxyphenyl)-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione (PubChem CID 135413840) has the molecular formula C17H17N5O5 and a molecular weight of 371.35 g/mol. Its IUPAC name is 10-(3,4,5-trimethoxyphenyl)-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione.
| Compound Name | 10-(3,4,5-trimethoxyphenyl)-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione |
|---|---|
| PubChem CID | 135413840 |
| Molecular Formula | C17H17N5O5 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 10-(3,4,5-trimethoxyphenyl)-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione |
| SMILES | COc1cc(C2CC(=O)Nc3c2c(=O)[nH]c2ncnn32)cc(OC)c1OC |
| InChI | InChI=1S/C17H17N5O5/c1-25-10-4-8(5-11(26-2)14(10)27-3)9-6-12(23)20-15-13(9)16(24)21-17-18-7-19-22(15)17/h4-5,7,9H,6H2,1-3H3,(H,20,23)(H,18,19,21,24) |
| InChIKey | XBYYAWOQWHFGIX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |