C14H10FN5O2 — CID 135831126
(10R)-10-(3-fluorophenyl)-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione (PubChem CID 135831126) has the molecular formula C14H10FN5O2 and a molecular weight of 299.27 g/mol. Its IUPAC name is (10R)-10-(3-fluorophenyl)-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione.
| Compound Name | (10R)-10-(3-fluorophenyl)-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione |
|---|---|
| PubChem CID | 135831126 |
| Molecular Formula | C14H10FN5O2 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (10R)-10-(3-fluorophenyl)-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione |
| SMILES | O=C1C[C@H](c2cccc(F)c2)c2c(n3ncnc3[nH]c2=O)N1 |
| InChI | InChI=1S/C14H10FN5O2/c15-8-3-1-2-7(4-8)9-5-10(21)18-12-11(9)13(22)19-14-16-6-17-20(12)14/h1-4,6,9H,5H2,(H,18,21)(H,16,17,19,22)/t9-/m1/s1 |
| InChIKey | BYSHXKWCQPVLQJ-SECBINFHSA-N |
| XLogP | 1.03 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |