C11H10O4 — CID 98232209
(3S)-3-(3-methoxyphenyl)oxolane-2,5-dione (PubChem CID 98232209) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is (3S)-3-(3-methoxyphenyl)oxolane-2,5-dione.
| Compound Name | (3S)-3-(3-methoxyphenyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 98232209 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | (3S)-3-(3-methoxyphenyl)oxolane-2,5-dione |
| SMILES | COc1cccc([C@@H]2CC(=O)OC2=O)c1 |
| InChI | InChI=1S/C11H10O4/c1-14-8-4-2-3-7(5-8)9-6-10(12)15-11(9)13/h2-5,9H,6H2,1H3/t9-/m0/s1 |
| InChIKey | FBQPQJDZIGJWLI-VIFPVBQESA-N |
| XLogP | 1.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|