C11H7F3O4 — CID 144594368
3-[3-(trifluoromethoxy)phenyl]oxolane-2,5-dione (PubChem CID 144594368) has the molecular formula C11H7F3O4 and a molecular weight of 260.17 g/mol. Its IUPAC name is 3-[3-(trifluoromethoxy)phenyl]oxolane-2,5-dione.
| Compound Name | 3-[3-(trifluoromethoxy)phenyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 144594368 |
| Molecular Formula | C11H7F3O4 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 3-[3-(trifluoromethoxy)phenyl]oxolane-2,5-dione |
| SMILES | O=C1CC(c2cccc(OC(F)(F)F)c2)C(=O)O1 |
| InChI | InChI=1S/C11H7F3O4/c12-11(13,14)18-7-3-1-2-6(4-7)8-5-9(15)17-10(8)16/h1-4,8H,5H2 |
| InChIKey | PRYJFZBQCRWFRX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|