C12H12F3NO2S — CID 3304214
3-ethyl-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one (PubChem CID 3304214) has the molecular formula C12H12F3NO2S and a molecular weight of 291.29 g/mol. Its IUPAC name is 3-ethyl-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 3-ethyl-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3304214 |
| Molecular Formula | C12H12F3NO2S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 3-ethyl-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)CSC1c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3NO2S/c1-2-16-10(17)7-19-11(16)8-4-3-5-9(6-8)18-12(13,14)15/h3-6,11H,2,7H2,1H3 |
| InChIKey | SLYBHHKGNMFPDF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |