C17H12OS — CID 134970084
(1R)-1-phenyl-1,2-dihydrocyclopenta[b][1]benzothiol-3-one (PubChem CID 134970084) has the molecular formula C17H12OS and a molecular weight of 264.35 g/mol. Its IUPAC name is (1R)-1-phenyl-1,2-dihydrocyclopenta[b][1]benzothiol-3-one.
| Compound Name | (1R)-1-phenyl-1,2-dihydrocyclopenta[b][1]benzothiol-3-one |
|---|---|
| PubChem CID | 134970084 |
| Molecular Formula | C17H12OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (1R)-1-phenyl-1,2-dihydrocyclopenta[b][1]benzothiol-3-one |
| SMILES | O=C1C[C@H](c2ccccc2)c2c1sc1ccccc21 |
| InChI | InChI=1S/C17H12OS/c18-14-10-13(11-6-2-1-3-7-11)16-12-8-4-5-9-15(12)19-17(14)16/h1-9,13H,10H2/t13-/m1/s1 |
| InChIKey | LDZCGVUWENZDLG-CYBMUJFWSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |