C18H17NOS — CID 12666898
2-methyl-2-oxido-1-phenyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyridin-2-ium (PubChem CID 12666898) has the molecular formula C18H17NOS and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-methyl-2-oxido-1-phenyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyridin-2-ium.
| Compound Name | 2-methyl-2-oxido-1-phenyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyridin-2-ium |
|---|---|
| PubChem CID | 12666898 |
| Molecular Formula | C18H17NOS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-methyl-2-oxido-1-phenyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyridin-2-ium |
| SMILES | C[N+]1([O-])CCc2c(sc3ccccc23)C1c1ccccc1 |
| InChI | InChI=1S/C18H17NOS/c1-19(20)12-11-15-14-9-5-6-10-16(14)21-18(15)17(19)13-7-3-2-4-8-13/h2-10,17H,11-12H2,1H3 |
| InChIKey | RJVGVGUXNIBPQT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|