C14H16S — CID 154947836
3,4-dimethyl-1,2,3,4-tetrahydrodibenzothiophene (PubChem CID 154947836) has the molecular formula C14H16S and a molecular weight of 216.35 g/mol. Its IUPAC name is 3,4-dimethyl-1,2,3,4-tetrahydrodibenzothiophene.
| Compound Name | 3,4-dimethyl-1,2,3,4-tetrahydrodibenzothiophene |
|---|---|
| PubChem CID | 154947836 |
| Molecular Formula | C14H16S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 3,4-dimethyl-1,2,3,4-tetrahydrodibenzothiophene |
| SMILES | CC1CCc2c(sc3ccccc23)C1C |
| InChI | InChI=1S/C14H16S/c1-9-7-8-12-11-5-3-4-6-13(11)15-14(12)10(9)2/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | LDFAYBCIWAEAAY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |