C13H13BrS — CID 115418076
4-bromo-1-methyl-1,2,3,4-tetrahydrodibenzothiophene (PubChem CID 115418076) has the molecular formula C13H13BrS and a molecular weight of 281.22 g/mol. Its IUPAC name is 4-bromo-1-methyl-1,2,3,4-tetrahydrodibenzothiophene.
| Compound Name | 4-bromo-1-methyl-1,2,3,4-tetrahydrodibenzothiophene |
|---|---|
| PubChem CID | 115418076 |
| Molecular Formula | C13H13BrS |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 4-bromo-1-methyl-1,2,3,4-tetrahydrodibenzothiophene |
| SMILES | CC1CCC(Br)c2sc3ccccc3c21 |
| InChI | InChI=1S/C13H13BrS/c1-8-6-7-10(14)13-12(8)9-4-2-3-5-11(9)15-13/h2-5,8,10H,6-7H2,1H3 |
| InChIKey | KVMUNIMYWDGSEV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|