C14H12S — CID 142416250
13-methyl-8-thiatetracyclo[7.5.0.02,7.012,14]tetradeca-1(9),2,4,6,10-pentaene (PubChem CID 142416250) has the molecular formula C14H12S and a molecular weight of 212.32 g/mol. Its IUPAC name is 13-methyl-8-thiatetracyclo[7.5.0.02,7.012,14]tetradeca-1(9),2,4,6,10-pentaene.
| Compound Name | 13-methyl-8-thiatetracyclo[7.5.0.02,7.012,14]tetradeca-1(9),2,4,6,10-pentaene |
|---|---|
| PubChem CID | 142416250 |
| Molecular Formula | C14H12S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 13-methyl-8-thiatetracyclo[7.5.0.02,7.012,14]tetradeca-1(9),2,4,6,10-pentaene |
| SMILES | CC1C2C=Cc3sc4ccccc4c3C12 |
| InChI | InChI=1S/C14H12S/c1-8-9-6-7-12-14(13(8)9)10-4-2-3-5-11(10)15-12/h2-9,13H,1H3 |
| InChIKey | KQJOWWJJEVWDMU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |