C12H9BrS — CID 135176935
2-bromo-1,2-dihydrodibenzothiophene (PubChem CID 135176935) has the molecular formula C12H9BrS and a molecular weight of 265.18 g/mol. Its IUPAC name is 2-bromo-1,2-dihydrodibenzothiophene.
| Compound Name | 2-bromo-1,2-dihydrodibenzothiophene |
|---|---|
| PubChem CID | 135176935 |
| Molecular Formula | C12H9BrS |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | 2-bromo-1,2-dihydrodibenzothiophene |
| SMILES | BrC1C=Cc2sc3ccccc3c2C1 |
| InChI | InChI=1S/C12H9BrS/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-6,8H,7H2 |
| InChIKey | JURZLNQGVSAOGF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|