C12H10BrN — CID 66807686
3-bromo-4,9-dihydro-3H-carbazole (PubChem CID 66807686) has the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. Its IUPAC name is 3-bromo-4,9-dihydro-3H-carbazole.
| Compound Name | 3-bromo-4,9-dihydro-3H-carbazole |
|---|---|
| PubChem CID | 66807686 |
| Molecular Formula | C12H10BrN |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 3-bromo-4,9-dihydro-3H-carbazole |
| SMILES | BrC1C=Cc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C12H10BrN/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-6,8,14H,7H2 |
| InChIKey | OBCGKCLNPMJUPJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|