C18H21Br2N — CID 174721399
3,3-bis(3-bromopropyl)-4,9-dihydrocarbazole (PubChem CID 174721399) has the molecular formula C18H21Br2N and a molecular weight of 411.18 g/mol. Its IUPAC name is 3,3-bis(3-bromopropyl)-4,9-dihydrocarbazole.
| Compound Name | 3,3-bis(3-bromopropyl)-4,9-dihydrocarbazole |
|---|---|
| PubChem CID | 174721399 |
| Molecular Formula | C18H21Br2N |
| Molecular Weight | 411.18 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | 3,3-bis(3-bromopropyl)-4,9-dihydrocarbazole |
| SMILES | BrCCCC1(CCCBr)C=Cc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C18H21Br2N/c19-11-3-8-18(9-4-12-20)10-7-17-15(13-18)14-5-1-2-6-16(14)21-17/h1-2,5-7,10,21H,3-4,8-9,11-13H2 |
| InChIKey | IXLSHLDFOTYCRA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.18 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|