C14H15N2+ — CID 66560100
2-prop-2-enyl-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium (PubChem CID 66560100) has the molecular formula C14H15N2+ and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-prop-2-enyl-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium.
| Compound Name | 2-prop-2-enyl-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 66560100 |
| Molecular Formula | C14H15N2+ |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-prop-2-enyl-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium |
| SMILES | C=CC[N+]1=Cc2[nH]c3ccccc3c2CC1 |
| InChI | InChI=1S/C14H14N2/c1-2-8-16-9-7-12-11-5-3-4-6-13(11)15-14(12)10-16/h2-6,10H,1,7-9H2/p+1 |
| InChIKey | AACMBKDMDKQLHS-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 18.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|