C17H14BrN2+ — CID 135060687
2-(4-bromophenyl)-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium (PubChem CID 135060687) has the molecular formula C17H14BrN2+ and a molecular weight of 326.22 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium.
| Compound Name | 2-(4-bromophenyl)-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 135060687 |
| Molecular Formula | C17H14BrN2+ |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2-(4-bromophenyl)-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium |
| SMILES | Brc1ccc([N+]2=Cc3[nH]c4ccccc4c3CC2)cc1 |
| InChI | InChI=1S/C17H13BrN2/c18-12-5-7-13(8-6-12)20-10-9-15-14-3-1-2-4-16(14)19-17(15)11-20/h1-8,11H,9-10H2/p+1 |
| InChIKey | YURISQNNAIRPAU-UHFFFAOYSA-O |
| XLogP | 4.25 |
| TPSA | 18.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|