C13H15ClN2O — CID 10083486
2-(methoxymethyl)-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium chloride (PubChem CID 10083486) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is 2-(methoxymethyl)-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium chloride.
| Compound Name | 2-(methoxymethyl)-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium chloride |
|---|---|
| PubChem CID | 10083486 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-(methoxymethyl)-4,9-dihydro-3H-pyrido[3,4-b]indol-2-ium chloride |
| SMILES | COC[N+]1=Cc2[nH]c3ccccc3c2CC1.[Cl-] |
| InChI | InChI=1S/C13H14N2O.ClH/c1-16-9-15-7-6-11-10-4-2-3-5-12(10)14-13(11)8-15;/h2-5,8H,6-7,9H2,1H3;1H |
| InChIKey | UJQGENNMUADANT-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 28.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|