C15H20N2OY-2 — CID 59190013
carbanide;2-methanidyl-3-(methoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;yttrium (PubChem CID 59190013) has the molecular formula C15H20N2OY-2 and a molecular weight of 333.24 g/mol. Its IUPAC name is carbanide;2-methanidyl-3-(methoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;yttrium.
| Compound Name | carbanide;2-methanidyl-3-(methoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;yttrium |
|---|---|
| PubChem CID | 59190013 |
| Molecular Formula | C15H20N2OY-2 |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | carbanide;2-methanidyl-3-(methoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;yttrium |
| SMILES | [CH2-]N1Cc2[nH]c3ccccc3c2CC1COC.[CH3-].[Y] |
| InChI | InChI=1S/C14H17N2O.CH3.Y/c1-16-8-14-12(7-10(16)9-17-2)11-5-3-4-6-13(11)15-14;;/h3-6,10,15H,1,7-9H2,2H3;1H3;/q2*-1; |
| InChIKey | BJZPHKVQDXCXMX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|