C14H16N2OS2 — CID 88678040
(3S)-3-(methoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioic acid (PubChem CID 88678040) has the molecular formula C14H16N2OS2 and a molecular weight of 292.43 g/mol. Its IUPAC name is (3S)-3-(methoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioic acid.
| Compound Name | (3S)-3-(methoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioic acid |
|---|---|
| PubChem CID | 88678040 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (3S)-3-(methoxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioic acid |
| SMILES | COC[C@@H]1Cc2c([nH]c3ccccc23)CN1C(=S)S |
| InChI | InChI=1S/C14H16N2OS2/c1-17-8-9-6-11-10-4-2-3-5-12(10)15-13(11)7-16(9)14(18)19/h2-5,9,15H,6-8H2,1H3,(H,18,19)/t9-/m0/s1 |
| InChIKey | UOFFWMZRFPJTMU-VIFPVBQESA-N |
| XLogP | 2.76 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|