C23H34N2OS2 — CID 13392983
decyl (3S)-3-(hydroxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate (PubChem CID 13392983) has the molecular formula C23H34N2OS2 and a molecular weight of 418.67 g/mol. Its IUPAC name is decyl (3S)-3-(hydroxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate.
| Compound Name | decyl (3S)-3-(hydroxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate |
|---|---|
| PubChem CID | 13392983 |
| Molecular Formula | C23H34N2OS2 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | decyl (3S)-3-(hydroxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate |
| SMILES | CCCCCCCCCCSC(=S)N1Cc2[nH]c3ccccc3c2C[C@H]1CO |
| InChI | InChI=1S/C23H34N2OS2/c1-2-3-4-5-6-7-8-11-14-28-23(27)25-16-22-20(15-18(25)17-26)19-12-9-10-13-21(19)24-22/h9-10,12-13,18,24,26H,2-8,11,14-17H2,1H3/t18-/m0/s1 |
| InChIKey | SNCWGAKTFJSMEQ-SFHVURJKSA-N |
| XLogP | 6.05 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|