C18H21N3O2 — CID 7003475
(8S)-6-butyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 7003475) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is (8S)-6-butyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (8S)-6-butyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 7003475 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (8S)-6-butyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | CCCCN1CC(=O)N2Cc3[nH]c4ccccc4c3C[C@H]2C1=O |
| InChI | InChI=1S/C18H21N3O2/c1-2-3-8-20-11-17(22)21-10-15-13(9-16(21)18(20)23)12-6-4-5-7-14(12)19-15/h4-7,16,19H,2-3,8-11H2,1H3/t16-/m0/s1 |
| InChIKey | QRXFYQWKXHDFCF-INIZCTEOSA-N |
| XLogP | 2.06 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|