C22H23N3O2S — CID 19358891
6-butyl-5-thiophen-2-yl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 19358891) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is 6-butyl-5-thiophen-2-yl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | 6-butyl-5-thiophen-2-yl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 19358891 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 6-butyl-5-thiophen-2-yl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | CCCCN1C(=O)C2Cc3c([nH]c4ccccc34)CN2C(=O)C1c1cccs1 |
| InChI | InChI=1S/C22H23N3O2S/c1-2-3-10-24-20(19-9-6-11-28-19)22(27)25-13-17-15(12-18(25)21(24)26)14-7-4-5-8-16(14)23-17/h4-9,11,18,20,23H,2-3,10,12-13H2,1H3 |
| InChIKey | IOSCJMPPTRILNV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|