C24H35N3O — CID 10339831
(3R)-N-cyclohexyl-2-hexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide (PubChem CID 10339831) has the molecular formula C24H35N3O and a molecular weight of 381.56 g/mol. Its IUPAC name is (3R)-N-cyclohexyl-2-hexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide.
| Compound Name | (3R)-N-cyclohexyl-2-hexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 10339831 |
| Molecular Formula | C24H35N3O |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | (3R)-N-cyclohexyl-2-hexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide |
| SMILES | CCCCCCN1Cc2[nH]c3ccccc3c2C[C@@H]1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C24H35N3O/c1-2-3-4-10-15-27-17-22-20(19-13-8-9-14-21(19)26-22)16-23(27)24(28)25-18-11-6-5-7-12-18/h8-9,13-14,18,23,26H,2-7,10-12,15-17H2,1H3,(H,25,28)/t23-/m1/s1 |
| InChIKey | AZVHKKFWRXZFLK-HSZRJFAPSA-N |
| XLogP | 4.92 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|