C26H32N4O3 — CID 22729506
6-amino-2-[[2-[(4-methylphenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]hexanoic acid (PubChem CID 22729506) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 6-amino-2-[[2-[(4-methylphenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[(4-methylphenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22729506 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 6-amino-2-[[2-[(4-methylphenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]hexanoic acid |
| SMILES | Cc1ccc(CN2Cc3[nH]c4ccccc4c3CC2C(=O)NC(CCCCN)C(=O)O)cc1 |
| InChI | InChI=1S/C26H32N4O3/c1-17-9-11-18(12-10-17)15-30-16-23-20(19-6-2-3-7-21(19)28-23)14-24(30)25(31)29-22(26(32)33)8-4-5-13-27/h2-3,6-7,9-12,22,24,28H,4-5,8,13-16,27H2,1H3,(H,29,31)(H,32,33) |
| InChIKey | UQQGKVGIWGTEDO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|