C29H38N4O5S — CID 10209591
tert-butyl 6-amino-2-[[2-(4-methylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]hexanoate (PubChem CID 10209591) has the molecular formula C29H38N4O5S and a molecular weight of 554.71 g/mol. Its IUPAC name is tert-butyl 6-amino-2-[[2-(4-methylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]hexanoate.
| Compound Name | tert-butyl 6-amino-2-[[2-(4-methylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 10209591 |
| Molecular Formula | C29H38N4O5S |
| Molecular Weight | 554.71 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | tert-butyl 6-amino-2-[[2-(4-methylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carbonyl]amino]hexanoate |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3[nH]c4ccccc4c3CC2C(=O)NC(CCCCN)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H38N4O5S/c1-19-12-14-20(15-13-19)39(36,37)33-18-25-22(21-9-5-6-10-23(21)31-25)17-26(33)27(34)32-24(11-7-8-16-30)28(35)38-29(2,3)4/h5-6,9-10,12-15,24,26,31H,7-8,11,16-18,30H2,1-4H3,(H,32,34) |
| InChIKey | AUIVFOQSNJTHAN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.71 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|