C19H16Cl2N2O4S — CID 134144323
methyl (3S)-2-(2,5-dichlorophenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 134144323) has the molecular formula C19H16Cl2N2O4S and a molecular weight of 439.32 g/mol. Its IUPAC name is methyl (3S)-2-(2,5-dichlorophenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (3S)-2-(2,5-dichlorophenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 134144323 |
| Molecular Formula | C19H16Cl2N2O4S |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | methyl (3S)-2-(2,5-dichlorophenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)CN1S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O4S/c1-27-19(24)17-9-13-12-4-2-3-5-15(12)22-16(13)10-23(17)28(25,26)18-8-11(20)6-7-14(18)21/h2-8,17,22H,9-10H2,1H3/t17-/m0/s1 |
| InChIKey | KOPGNEDCUQUWHX-KRWDZBQOSA-N |
| XLogP | 3.76 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|