C31H49N5O6S — CID 59890522
tert-butyl 6-amino-2-[[(2R,3S)-3-(1H-indol-3-yl)-2-[(1-propan-2-ylsulfonylpiperidine-4-carbonyl)amino]butanoyl]amino]hexanoate (PubChem CID 59890522) has the molecular formula C31H49N5O6S and a molecular weight of 619.83 g/mol. Its IUPAC name is tert-butyl 6-amino-2-[[(2R,3S)-3-(1H-indol-3-yl)-2-[(1-propan-2-ylsulfonylpiperidine-4-carbonyl)amino]butanoyl]amino]hexanoate.
| Compound Name | tert-butyl 6-amino-2-[[(2R,3S)-3-(1H-indol-3-yl)-2-[(1-propan-2-ylsulfonylpiperidine-4-carbonyl)amino]butanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 59890522 |
| Molecular Formula | C31H49N5O6S |
| Molecular Weight | 619.83 g/mol |
| Exact Mass | 619.34 |
| IUPAC Name | tert-butyl 6-amino-2-[[(2R,3S)-3-(1H-indol-3-yl)-2-[(1-propan-2-ylsulfonylpiperidine-4-carbonyl)amino]butanoyl]amino]hexanoate |
| SMILES | CC(C)S(=O)(=O)N1CCC(C(=O)N[C@@H](C(=O)NC(CCCCN)C(=O)OC(C)(C)C)[C@@H](C)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C31H49N5O6S/c1-20(2)43(40,41)36-17-14-22(15-18-36)28(37)35-27(21(3)24-19-33-25-12-8-7-11-23(24)25)29(38)34-26(13-9-10-16-32)30(39)42-31(4,5)6/h7-8,11-12,19-22,26-27,33H,9-10,13-18,32H2,1-6H3,(H,34,38)(H,35,37)/t21-,26?,27+/m0/s1 |
| InChIKey | WNWXKXRXXZUWLW-HLDDYPLSSA-N |
| XLogP | 3.16 |
| TPSA | 163.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.83 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|