C30H47N5O4 — CID 21334266
tert-butyl 2-[[3-(1H-indol-3-yl)-2-[(1-methylpiperidine-3-carbonyl)amino]butanoyl]amino]-6-(methylamino)hexanoate (PubChem CID 21334266) has the molecular formula C30H47N5O4 and a molecular weight of 541.74 g/mol. Its IUPAC name is tert-butyl 2-[[3-(1H-indol-3-yl)-2-[(1-methylpiperidine-3-carbonyl)amino]butanoyl]amino]-6-(methylamino)hexanoate.
| Compound Name | tert-butyl 2-[[3-(1H-indol-3-yl)-2-[(1-methylpiperidine-3-carbonyl)amino]butanoyl]amino]-6-(methylamino)hexanoate |
|---|---|
| PubChem CID | 21334266 |
| Molecular Formula | C30H47N5O4 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.36 |
| IUPAC Name | tert-butyl 2-[[3-(1H-indol-3-yl)-2-[(1-methylpiperidine-3-carbonyl)amino]butanoyl]amino]-6-(methylamino)hexanoate |
| SMILES | CNCCCCC(NC(=O)C(NC(=O)C1CCCN(C)C1)C(C)c1c[nH]c2ccccc12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H47N5O4/c1-20(23-18-32-24-14-8-7-13-22(23)24)26(34-27(36)21-12-11-17-35(6)19-21)28(37)33-25(15-9-10-16-31-5)29(38)39-30(2,3)4/h7-8,13-14,18,20-21,25-26,31-32H,9-12,15-17,19H2,1-6H3,(H,33,37)(H,34,36) |
| InChIKey | RLZGQZVQONGYAB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|