C35H49N5O4 — CID 21334277
tert-butyl 6-amino-2-[[2-[(1-benzylpiperidine-3-carbonyl)amino]-3-(1H-indol-3-yl)butanoyl]amino]hexanoate (PubChem CID 21334277) has the molecular formula C35H49N5O4 and a molecular weight of 603.81 g/mol. Its IUPAC name is tert-butyl 6-amino-2-[[2-[(1-benzylpiperidine-3-carbonyl)amino]-3-(1H-indol-3-yl)butanoyl]amino]hexanoate.
| Compound Name | tert-butyl 6-amino-2-[[2-[(1-benzylpiperidine-3-carbonyl)amino]-3-(1H-indol-3-yl)butanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 21334277 |
| Molecular Formula | C35H49N5O4 |
| Molecular Weight | 603.81 g/mol |
| Exact Mass | 603.38 |
| IUPAC Name | tert-butyl 6-amino-2-[[2-[(1-benzylpiperidine-3-carbonyl)amino]-3-(1H-indol-3-yl)butanoyl]amino]hexanoate |
| SMILES | CC(c1c[nH]c2ccccc12)C(NC(=O)C1CCCN(Cc2ccccc2)C1)C(=O)NC(CCCCN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H49N5O4/c1-24(28-21-37-29-17-9-8-16-27(28)29)31(33(42)38-30(18-10-11-19-36)34(43)44-35(2,3)4)39-32(41)26-15-12-20-40(23-26)22-25-13-6-5-7-14-25/h5-9,13-14,16-17,21,24,26,30-31,37H,10-12,15,18-20,22-23,36H2,1-4H3,(H,38,42)(H,39,41) |
| InChIKey | KJDPZFINBIEQAX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.81 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|