C29H36N4O2 — CID 58590778
N-[(2R)-1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-benzylpiperidine-3-carboxamide (PubChem CID 58590778) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is N-[(2R)-1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-benzylpiperidine-3-carboxamide.
| Compound Name | N-[(2R)-1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-benzylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 58590778 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | N-[(2R)-1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-1-benzylpiperidine-3-carboxamide |
| SMILES | NCCCNC(=O)[C@@H](Cc1ccc2ccccc2c1)NC(=O)C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C29H36N4O2/c30-15-7-16-31-29(35)27(19-23-13-14-24-10-4-5-11-25(24)18-23)32-28(34)26-12-6-17-33(21-26)20-22-8-2-1-3-9-22/h1-5,8-11,13-14,18,26-27H,6-7,12,15-17,19-21,30H2,(H,31,35)(H,32,34)/t26?,27-/m1/s1 |
| InChIKey | NFABERJIKLCXRC-SSYAZFEXSA-N |
| XLogP | 3.24 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|