C30H38N4O2 — CID 143866803
1-(4-aminobutyl)-3-[1-(3-benzylpiperidin-1-yl)-3-naphthalen-2-yl-1-oxopropan-2-yl]urea (PubChem CID 143866803) has the molecular formula C30H38N4O2 and a molecular weight of 486.66 g/mol. Its IUPAC name is 1-(4-aminobutyl)-3-[1-(3-benzylpiperidin-1-yl)-3-naphthalen-2-yl-1-oxopropan-2-yl]urea.
| Compound Name | 1-(4-aminobutyl)-3-[1-(3-benzylpiperidin-1-yl)-3-naphthalen-2-yl-1-oxopropan-2-yl]urea |
|---|---|
| PubChem CID | 143866803 |
| Molecular Formula | C30H38N4O2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 1-(4-aminobutyl)-3-[1-(3-benzylpiperidin-1-yl)-3-naphthalen-2-yl-1-oxopropan-2-yl]urea |
| SMILES | NCCCCNC(=O)NC(Cc1ccc2ccccc2c1)C(=O)N1CCCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C30H38N4O2/c31-16-6-7-17-32-30(36)33-28(21-24-14-15-26-12-4-5-13-27(26)20-24)29(35)34-18-8-11-25(22-34)19-23-9-2-1-3-10-23/h1-5,9-10,12-15,20,25,28H,6-8,11,16-19,21-22,31H2,(H2,32,33,36) |
| InChIKey | MBEWZCGQXGACSY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|